Ацетат марганца(II)

Материал из Выращивание кристаллов

<amp/>


   Ацетат марганца(II)  
Названия: марганца(II) ацетат
марганца диацетат
марганец(II) уксуснокислый

Формула: Mn(CH3COO)2 (безводный)
Mn(CH3COO)2 · 4H2O (тетрагидрат)
SMILES: CC([O-])=O.CC([O-])=O.[Mn+2]
Молярная масса: 173,026 г/моль (безводный)
245,085 г/моль (тетрагидрат)
Плотность: 1,74 г/см3 (безводный)
1,589 г/см3 (тетрагидрат)
Сингония: моноклинная (тетрагидрат)
a=11,1 Å, b=17,51 Å, c=9,09 Åα=90°, β=118,62°, γ=90°
Формы:
https://media.crystalls.info/w/uploads/media/Rhombic_pedion.json
https://media.crystalls.info/w/uploads/media/Parallelogram.json
https://media.crystalls.info/w/uploads/media/Rhombic_prism.json

Цвет: светло-розовый
Температура плавления: 80 °C353,15 K <br />176 °F <br />635,67 °R <br /> (тетрагидрат)
Температура разложения: 210 °C483,15 K <br />410 °F <br />869,67 °R <br /> (безводный)
Магнитные свойства: парамагнетик
Устойчивость: стабилен (тетрагидрат)
Прочность: хрупок
Токсичность: не токсичен
ЛД50=2940мг/кг

Описание

Органическое соединение, соль двухвалентного переходного металла марганца и органической уксусной кислоты. Из водных растворов кристаллизуется в виде тетрагидрата.

Методы получения

Взаимодействие гидроксокарбоната, карбоната или гидроксида марганца(II) и избытка уксусной кислоты

Уравнение реакции:

4CH3COOH + Mn2(CO3)(OH)2 = 2Mn(CH3COO)2 + 3H2O + CO2
2CH3COOH + MnCO3 = Mn(CH3COO)2 + H2O + CO2
2CH3COOH + Mn(OH)2 = Mn(CH3COO)2 + 2H2O


Для получения 100,00 грамм тетрагидрата ацетата марганца(II) требуется 41,60 грамм гидроксокарбоната или 46,90 грамм карбоната или 36,29 грамм гидроксида и 70,01 грамм 70% уксусной кислоты.

В емкость с кислотой небольшими порциями добавляют соответствующее соединение марганца и перемешивают до его полного растворения, а в случае с карбонатом - до прекращения выделения углекислого газа. После завершения реакции раствор фильтруют и используют для выращивания кристаллов.

Взаимодействие хлорида, сульфата или нитрата марганца(II) и избытка концентрированной уксусной кислоты

Уравнение реакции:

2CH3COOH + MnCl2 = Mn(CH3COO)2↓ + 2HCl
2CH3COOH + MnSO4 = Mn(CH3COO)2↓ + H2SO4
2CH3COOH + Mn(NO3)2 = Mn(CH3COO)2↓ + 2HNO3


Для получения 100,00 грамм тетрагидрата ацетата марганца(II) требуется 80,75 грамм тетрагидрата хлорида марганца(II) или 113,06 грамм гептагидрата сульфата марганца(II) или 117,12 грамм гексагидрата нитрата марганца(II) и 49,00 грамм ледяной уксусной кислоты.

В емкость с насыщенным раствором соединения марганца комнатной температуры вливают концентрированный раствор кислоты и перемешивают. При замораживании смеси выделяется большое количество кристаллического осадка. Осадок отфильтровывают, промывают небольшим количеством ледяной уксусной кислоты, растворяют в воде, после чего раствор используют для выращивания кристаллов.

Взаимодействие нитрата марганца(II) и ацетата натрия

Уравнение реакции:

2NaCH3COO + Mn(NO3)2 = Mn(CH3COO)2↓ + 2NaNO3


Для получения 100,00 грамм тетрагидрата ацетата марганца(II) требуется 117,12 грамм гексагидрата нитрата марганца(II) и 111,05 грамм тригидрата ацетата натрия.

В емкость с горячим раствором нитрата марганца при кипячении вливают горячий раствор ацетата натрия и перемешивают. При охлаждении смеси выделяется большое количество кристаллического осадка. Осадок отфильтровывают, промывают небольшим количеством холодной воды, растворяют в воде, после чего раствор используют для выращивания кристаллов.

Взаимодействие сульфата марганца(II) и ацетата кальция или свинца(II)

При использовании солей свинца сульфат марганца можно заменить на его хлорид.
Уравнение реакции:

Ca(CH3COO)2 + MnSO4 = Mn(CH3COO)2 + CaSO4
Pb(CH3COO)2 + MnSO4 = Mn(CH3COO)2 + PbSO4
Pb(CH3COO)2 + MnCl2 = Mn(CH3COO)2 + PbCl2


Для получения 100,00 грамм тетрагидрата ацетата марганца(II) требуется 80,75 грамм тетрагидрата хлорида марганца(II) или 113,06 грамм гептагидрата сульфата марганца(II) и 71,89 грамм моногидрата ацетата кальция или 154,78 грамм тригидрата ацетата свинца(II).

В емкость с раствором ацетата кальция или свинца(II) небольшими порциями при перемешивании вливают раствор соли марганца. Выпадает большое количество малорастворимого осадка. Его отделяют отстаиванием и выбрасывают, после чего оставшийся раствор тщательно фильтруют.

Влияние примесей

Водные растворы подвержены гидролизу, к тому же достаточно быстро окисляются кислородом воздуха до ацетата марганца(III) коричневого цвета.
Поэтому для стабильности раствора нужен избыток уксусной кислоты.

Примечания

Имеет склонность к образованию пересыщенных растворов. Кристаллизация начинается при помещении затравки в емкость с раствором.

Условия хранения

Хранить в исходном виде или под несколькими слоями лака, при средней влажности воздуха и комнатной температуре. Не хранить в спичечных коробках или вате и не нагревать.

Растворимость

Температурагр/100,00 гр водыгр/100,00 гр метанола
(безводный)(тетрагидрат)(безводный)
0°C273,15 K <br />32 °F <br />491,67 °R <br />~33
15°C288,15 K <br />59 °F <br />518,67 °R <br />4,76
50°C323,15 K <br />122 °F <br />581,67 °R <br />38,164,5
70°C343,15 K <br />158 °F <br />617,67 °R <br />12,3
Растворим в этаноле и уксусной кислоте. Нерастворим в ацетоне.


Галерея


Источники


Навигация