Нитрат железа(II)

Материал из Выращивание кристаллов

<amp/>


   Нитрат железа(II)  
Названия: железа(II) нитрат

Формула: Fe(NO3)2 (безводный)
Fe(NO3)2 · 6H2O (гексагидрат)
Fe(NO3)2 · 9H2O (нонагидрат)
SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Fe+2]
Молярная масса: 179,853 г/моль (безводный)
287,942 г/моль (гексагидрат)
341,987 г/моль (нонагидрат)
Сингония: ромбическая (гексагидрат)
α=90°, β=90°, γ=90°
Формы:
https://media.crystalls.info/w/uploads/media/Prolongated_hexagonal_flat_prism.json
https://media.crystalls.info/w/uploads/media/Trapezoidal_flat_prism.json

Цвет: бледно-зеленый
Температура плавления: 60,5 °C333,65 K <br />140,9 °F <br />600,57 °R <br /> (гексагидрат)
Температура разложения: 12 °C285,15 K <br />53,6 °F <br />513,27 °R <br /> (нонагидрат)
61 °C334,15 K <br />141,8 °F <br />601,47 °R <br /> (гексагидрат)
Магнитные свойства: парамагнетик
Устойчивость: стабилен (гексагидрат)
гигроскопичен (безводный)
Прочность: хрупок
Токсичность: слабо токсичен

Описание

Неорганическое соединение, соль двухвалентного переходного металла железа и неорганической азотной кислоты. Из водных растворов кристаллизуется в виде гексагидрата и нонагидрата.

Методы получения

Взаимодействие оксида, сульфида, гидроксида или гидроксокарбоната железа(II) и азотной кислоты

Уравнение реакции:

FeO + 2HNO3 = Fe(NO3)2 + H2O
FeS + 2HNO3 = Fe(NO3)2 + H2S↑
Fe(OH)2 + 2HNO3 = Fe(NO3)2 + 2H2O
Fe2CO3(OH)2 + 4HNO3 = 2Fe(NO3)2 + CO2↑ + 3H2O


Для получения 100,00 грамм гексагидрата нитрата железа(II) требуется 24,95 грамм оксида или 30,53 грамм сульфида или 31,21 грамм гидроксида или 35,72 грамм гидроксокарбоната железа(II) и 67,33 грамм 65% кислоты.

В емкость с кислотой небольшими порциями добавляют соответствующее соединение железа и перемешивают до его полного растворения, а в случае с карбонатом - до прекращения выделения углекислого газа. После завершения реакции раствор фильтруют и используют для выращивания кристаллов.

Взаимодействие металлического железа и разбавленной азотной кислоты

Уравнение реакции:

4Fe + 10HNO3 = 4Fe(NO3)2 + NH4NO2 + 3H2O


Для получения 100,00 грамм гексагидрата нитрата железа(II) требуется 19,39 грамм чистого железа и 84,17 грамм 65% кислоты.

В емкость с холодной разбавленной кислотой добавляют железо в виде мелких кусочков, стружки или порошка, после чего перемешивают до прекращения выделения газа.

Взаимодействие сульфата железа(II) и нитрата кальция или свинца(II)

При использовании солей свинца сульфат железа можно заменить на его хлорид.
Уравнение реакции:

FeSO4 + Ca(NO3)2 = CaSO4↓ + Fe(NO3)2
FeSO4 + Pb(NO3)2 = PbSO4↓ + Fe(NO3)2
FeCl2 + Pb(NO3)2 = PbCl2↓ + Fe(NO3)2


Для получения 100,00 грамм гексагидрата нитрата железа(II) требуется 96,55 грамм гептагидрата сульфата железа(II) или 69,05 грамм тетрагидрата хлорида железа(II) и 115,03 грамм нитрата свинца(II) или 82,01 грамм тетрагидрата нитрата кальция.

В емкость с раствором нитрата кальция или свинца(II) небольшими порциями при перемешивании вливают раствор соли железа. Выпадает большое количество малорастворимого осадка. Его отделяют отстаиванием и выбрасывают, после чего оставшийся раствор тщательно фильтруют.

Взаимодействие гидроксида или гидроксокарбоната железа(II) и нитрата аммония

Уравнение реакции:

Fe(OH)2 + 2NH4NO3 = Fe(NO3)2 + 2H2O + 2NH3
Fe2CO3(OH)2 + 4NH4NO3 = 2Fe(NO3)2 + 3H2O + 2NH3↑ + CO2


Для получения 100,00 грамм гексагидрата нитрата железа(II) требуется 31,21 грамм гидроксида или 35,72 грамм гидроксокарбоната железа(II) и 55,60 грамм нитрата аммония.

В емкость со взвесью соединения железа в воде небольшими порциями добавляют горячий раствор нитрата аммония и кипятят при интенсивном перемешивании до прекращения выделения газа и исчезновения запаха.Осторожно, выделяющийся аммиак сильно раздражает глаза и легкие! Процедуру проводить исключительно в вытяжном шкафу или на открытом воздухе!

Примечания

Раствор поглощает влагу из воздуха, из-за чего растить достаточно тяжело.

Условия хранения

Хранить в исходном виде или под несколькими слоями лака, при средней влажности воздуха и комнатной температуре. Не хранить в спичечных коробках или вате и не нагревать.

Растворимость

Температурагр/100,00 гр воды
(безводный)(гексагидрат)
0°C273,15 K <br />32 °F <br />491,67 °R <br />71,03113
10°C283,15 K <br />50 °F <br />509,67 °R <br />~76,8134
15°C288,15 K <br />59 °F <br />518,67 °R <br />~79,6
20°C293,15 K <br />68 °F <br />527,67 °R <br />82,48
25°C298,15 K <br />77 °F <br />536,67 °R <br />86,92
30°C303,15 K <br />86 °F <br />545,67 °R <br />~98,3
40°C313,15 K <br />104 °F <br />563,67 °R <br />~121
50°C323,15 K <br />122 °F <br />581,67 °R <br />~144
60°C333,15 K <br />140 °F <br />599,67 °R <br />166,67


Галерея


Источники


Навигация